C10H12N2O7S — CID 43361824
3-[(2-methoxy-4-nitrophenyl)sulfamoyl]propanoic acid (PubChem CID 43361824) has the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-[(2-methoxy-4-nitrophenyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(2-methoxy-4-nitrophenyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43361824 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-[(2-methoxy-4-nitrophenyl)sulfamoyl]propanoic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C10H12N2O7S/c1-19-9-6-7(12(15)16)2-3-8(9)11-20(17,18)5-4-10(13)14/h2-3,6,11H,4-5H2,1H3,(H,13,14) |
| InChIKey | RWYQKXISBBYPCH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|