C11H14N2O6S — CID 43712843
4-[(2-methyl-4-nitrophenyl)sulfamoyl]butanoic acid (PubChem CID 43712843) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-[(2-methyl-4-nitrophenyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[(2-methyl-4-nitrophenyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 43712843 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-[(2-methyl-4-nitrophenyl)sulfamoyl]butanoic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NS(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C11H14N2O6S/c1-8-7-9(13(16)17)4-5-10(8)12-20(18,19)6-2-3-11(14)15/h4-5,7,12H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | IQOMUILWWNDFNC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|