C10H5Cl3N2O2 — CID 43363604
1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid (PubChem CID 43363604) has the molecular formula C10H5Cl3N2O2 and a molecular weight of 291.52 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 43363604 |
| Molecular Formula | C10H5Cl3N2O2 |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(-c2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H5Cl3N2O2/c11-5-3-7(13)9(4-6(5)12)15-2-1-8(14-15)10(16)17/h1-4H,(H,16,17) |
| InChIKey | JBJVVCGHJDKIIQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|