C16H18N2OS — CID 43367357
(2-amino-5-phenylthiophen-3-yl)-piperidin-1-ylmethanone (PubChem CID 43367357) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is (2-amino-5-phenylthiophen-3-yl)-piperidin-1-ylmethanone.
| Compound Name | (2-amino-5-phenylthiophen-3-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 43367357 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2-amino-5-phenylthiophen-3-yl)-piperidin-1-ylmethanone |
| SMILES | Nc1sc(-c2ccccc2)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H18N2OS/c17-15-13(16(19)18-9-5-2-6-10-18)11-14(20-15)12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10,17H2 |
| InChIKey | CHBXKKCFECVWGN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |