C13H11N2O3S- — CID 3667213
2-[(2-amino-5-phenylthiophene-3-carbonyl)amino]acetate (PubChem CID 3667213) has the molecular formula C13H11N2O3S- and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(2-amino-5-phenylthiophene-3-carbonyl)amino]acetate.
| Compound Name | 2-[(2-amino-5-phenylthiophene-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 3667213 |
| Molecular Formula | C13H11N2O3S- |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[(2-amino-5-phenylthiophene-3-carbonyl)amino]acetate |
| SMILES | Nc1sc(-c2ccccc2)cc1C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C13H12N2O3S/c14-12-9(13(18)15-7-11(16)17)6-10(19-12)8-4-2-1-3-5-8/h1-6H,7,14H2,(H,15,18)(H,16,17)/p-1 |
| InChIKey | FKHLXNADPODFIE-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |