C21H22N2OS — CID 134146525
2-amino-5-phenyl-N-(4-phenylbutyl)thiophene-3-carboxamide (PubChem CID 134146525) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-amino-5-phenyl-N-(4-phenylbutyl)thiophene-3-carboxamide.
| Compound Name | 2-amino-5-phenyl-N-(4-phenylbutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 134146525 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-amino-5-phenyl-N-(4-phenylbutyl)thiophene-3-carboxamide |
| SMILES | Nc1sc(-c2ccccc2)cc1C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C21H22N2OS/c22-20-18(15-19(25-20)17-12-5-2-6-13-17)21(24)23-14-8-7-11-16-9-3-1-4-10-16/h1-6,9-10,12-13,15H,7-8,11,14,22H2,(H,23,24) |
| InChIKey | DMJONCCMYZLQDF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|