C10H21N3O2 — CID 43367754
3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 43367754) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 43367754 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC1CN(CC(C)/C(N)=N/O)CC(C)O1 |
| InChI | InChI=1S/C10H21N3O2/c1-7(10(11)12-14)4-13-5-8(2)15-9(3)6-13/h7-9,14H,4-6H2,1-3H3,(H2,11,12) |
| InChIKey | ALXKJMBOJPVZMV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|