C16H15ClO2 — CID 43369973
1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanone (PubChem CID 43369973) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanone.
| Compound Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 43369973 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C16H15ClO2/c1-10-8-13(9-11(2)16(10)17)19-15-7-5-4-6-14(15)12(3)18/h4-9H,1-3H3 |
| InChIKey | PBTDLOPBVYHUSY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |