C16H17ClO2 — CID 43510297
1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanol (PubChem CID 43510297) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanol.
| Compound Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 43510297 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)phenyl]ethanol |
| SMILES | Cc1cc(Oc2ccccc2C(C)O)cc(C)c1Cl |
| InChI | InChI=1S/C16H17ClO2/c1-10-8-13(9-11(2)16(10)17)19-15-7-5-4-6-14(15)12(3)18/h4-9,12,18H,1-3H3 |
| InChIKey | JAQHEEHLYJJLJI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |