C11H12ClFN2O3S — CID 43385247
2-amino-3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 43385247) has the molecular formula C11H12ClFN2O3S and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-amino-3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43385247 |
| Molecular Formula | C11H12ClFN2O3S |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-amino-3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | NC(CSCC(=O)Nc1ccc(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12ClFN2O3S/c12-7-3-6(13)1-2-9(7)15-10(16)5-19-4-8(14)11(17)18/h1-3,8H,4-5,14H2,(H,15,16)(H,17,18) |
| InChIKey | PQCGNRNWFRAGPI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |