C12H19NO — CID 43387810
N-(2-ethoxyethyl)-2,5-dimethylaniline (PubChem CID 43387810) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2,5-dimethylaniline.
| Compound Name | N-(2-ethoxyethyl)-2,5-dimethylaniline |
|---|---|
| PubChem CID | 43387810 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(2-ethoxyethyl)-2,5-dimethylaniline |
| SMILES | CCOCCNc1cc(C)ccc1C |
| InChI | InChI=1S/C12H19NO/c1-4-14-8-7-13-12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | CYLGBGYBWFVFNU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|