About N-(2-ethoxyethyl)-2,5-dimethylaniline
N-(2-ethoxyethyl)-2,5-dimethylaniline (PubChem CID 43387810) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2,5-dimethylaniline.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-2,5-dimethylaniline |
| PubChem CID | 43387810 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(2-ethoxyethyl)-2,5-dimethylaniline |
| SMILES | CCOCCNc1cc(C)ccc1C |
| InChI | InChI=1S/C12H19NO/c1-4-14-8-7-13-12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | CYLGBGYBWFVFNU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-2,5-dimethylaniline?
The IUPAC name of N-(2-ethoxyethyl)-2,5-dimethylaniline (CID 43387810) is N-(2-ethoxyethyl)-2,5-dimethylaniline.
What is the SMILES notation for N-(2-ethoxyethyl)-2,5-dimethylaniline?
The canonical SMILES for N-(2-ethoxyethyl)-2,5-dimethylaniline is CCOCCNc1cc(C)ccc1C.
What is the InChIKey of N-(2-ethoxyethyl)-2,5-dimethylaniline?
The InChIKey is CYLGBGYBWFVFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-4-14-8-7-13-12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3.
What are the key properties of N-(2-ethoxyethyl)-2,5-dimethylaniline?
N-(2-ethoxyethyl)-2,5-dimethylaniline has a molecular weight of 193.29 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-2,5-dimethylaniline is sourced from PubChem (CID 43387810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).