C11H18N2OS — CID 43400102
N-ethyl-2-[(3-methylthiophen-2-yl)methylamino]propanamide (PubChem CID 43400102) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-ethyl-2-[(3-methylthiophen-2-yl)methylamino]propanamide.
| Compound Name | N-ethyl-2-[(3-methylthiophen-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 43400102 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-ethyl-2-[(3-methylthiophen-2-yl)methylamino]propanamide |
| SMILES | CCNC(=O)C(C)NCc1sccc1C |
| InChI | InChI=1S/C11H18N2OS/c1-4-12-11(14)9(3)13-7-10-8(2)5-6-15-10/h5-6,9,13H,4,7H2,1-3H3,(H,12,14) |
| InChIKey | CMNYBEZUXUGMOH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |