C11H16BrN3O2S — CID 78983667
2-[(3-bromothiophen-2-yl)methylamino]-N-(ethylcarbamoyl)propanamide (PubChem CID 78983667) has the molecular formula C11H16BrN3O2S and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methylamino]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)methylamino]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 78983667 |
| Molecular Formula | C11H16BrN3O2S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methylamino]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NCc1sccc1Br |
| InChI | InChI=1S/C11H16BrN3O2S/c1-3-13-11(17)15-10(16)7(2)14-6-9-8(12)4-5-18-9/h4-5,7,14H,3,6H2,1-2H3,(H2,13,15,16,17) |
| InChIKey | IWLUIOLJLJTSRP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |