C14H16BrNO3 — CID 43400285
2-bromo-4-[[1-(furan-2-yl)ethylamino]methyl]-6-methoxyphenol (PubChem CID 43400285) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is 2-bromo-4-[[1-(furan-2-yl)ethylamino]methyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[1-(furan-2-yl)ethylamino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 43400285 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-bromo-4-[[1-(furan-2-yl)ethylamino]methyl]-6-methoxyphenol |
| SMILES | COc1cc(CNC(C)c2ccco2)cc(Br)c1O |
| InChI | InChI=1S/C14H16BrNO3/c1-9(12-4-3-5-19-12)16-8-10-6-11(15)14(17)13(7-10)18-2/h3-7,9,16-17H,8H2,1-2H3 |
| InChIKey | HCJCDHLTWAYHKU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |