C15H19NO4 — CID 81402939
4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-2,6-dimethoxyphenol (PubChem CID 81402939) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 81402939 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CN[C@@H](C)c2ccco2)cc(OC)c1O |
| InChI | InChI=1S/C15H19NO4/c1-10(12-5-4-6-20-12)16-9-11-7-13(18-2)15(17)14(8-11)19-3/h4-8,10,16-17H,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | ZGKZCJZONJXIKN-JTQLQIEISA-N |
| XLogP | 2.85 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |