C11H18N2O2 — CID 43401095
2-[1-(furan-2-yl)ethylamino]-N,N-dimethylpropanamide (PubChem CID 43401095) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[1-(furan-2-yl)ethylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[1-(furan-2-yl)ethylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43401095 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[1-(furan-2-yl)ethylamino]-N,N-dimethylpropanamide |
| SMILES | CC(NC(C)c1ccco1)C(=O)N(C)C |
| InChI | InChI=1S/C11H18N2O2/c1-8(10-6-5-7-15-10)12-9(2)11(14)13(3)4/h5-9,12H,1-4H3 |
| InChIKey | BFFKNEPJEBVPJG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |