C13H22N2O2 — CID 81400011
N-butyl-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide (PubChem CID 81400011) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-butyl-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide.
| Compound Name | N-butyl-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 81400011 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-butyl-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N[C@H](C)c1ccco1 |
| InChI | InChI=1S/C13H22N2O2/c1-4-5-8-14-13(16)11(3)15-10(2)12-7-6-9-17-12/h6-7,9-11,15H,4-5,8H2,1-3H3,(H,14,16)/t10-,11?/m1/s1 |
| InChIKey | HCYGSNSORSPRCH-NFJWQWPMSA-N |
| XLogP | 2.23 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|