C19H36N2 — CID 43406667
4-N-(2-adamantyl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 43406667) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 4-N-(2-adamantyl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-(2-adamantyl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 43406667 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 4-N-(2-adamantyl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H36N2/c1-4-21(5-2)8-6-7-14(3)20-19-17-10-15-9-16(12-17)13-18(19)11-15/h14-20H,4-13H2,1-3H3 |
| InChIKey | WFPDFIWUFZYDPT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |