C16H12F2N2S — CID 43407819
3-fluoro-N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]aniline (PubChem CID 43407819) has the molecular formula C16H12F2N2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 3-fluoro-N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]aniline.
| Compound Name | 3-fluoro-N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 43407819 |
| Molecular Formula | C16H12F2N2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-fluoro-N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]aniline |
| SMILES | Fc1ccc(-c2nc(CNc3cccc(F)c3)cs2)cc1 |
| InChI | InChI=1S/C16H12F2N2S/c17-12-6-4-11(5-7-12)16-20-15(10-21-16)9-19-14-3-1-2-13(18)8-14/h1-8,10,19H,9H2 |
| InChIKey | RSQDNVHPRQLFCZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |