C12H10F4N2OS — CID 82711100
1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82711100) has the molecular formula C12H10F4N2OS and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82711100 |
| Molecular Formula | C12H10F4N2OS |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | Fc1ccc(-c2nc(CNOCC(F)(F)F)cs2)cc1 |
| InChI | InChI=1S/C12H10F4N2OS/c13-9-3-1-8(2-4-9)11-18-10(6-20-11)5-17-19-7-12(14,15)16/h1-4,6,17H,5,7H2 |
| InChIKey | MZSVQYAVGYGWOK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|