C11H11ClN2OS — CID 43407921
5-chloro-4-[(2,6-dimethylphenoxy)methyl]thiadiazole (PubChem CID 43407921) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 5-chloro-4-[(2,6-dimethylphenoxy)methyl]thiadiazole.
| Compound Name | 5-chloro-4-[(2,6-dimethylphenoxy)methyl]thiadiazole |
|---|---|
| PubChem CID | 43407921 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 5-chloro-4-[(2,6-dimethylphenoxy)methyl]thiadiazole |
| SMILES | Cc1cccc(C)c1OCc1nnsc1Cl |
| InChI | InChI=1S/C11H11ClN2OS/c1-7-4-3-5-8(2)10(7)15-6-9-11(12)16-14-13-9/h3-5H,6H2,1-2H3 |
| InChIKey | ZZLWRSLFZFIXJP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |