C12H11BrN2O3S — CID 43408988
methyl 3-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 43408988) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is methyl 3-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43408988 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | methyl 3-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C12H11BrN2O3S/c1-15-6-7(13)5-9(15)11(16)14-8-3-4-19-10(8)12(17)18-2/h3-6H,1-2H3,(H,14,16) |
| InChIKey | MSQNLJPTZWILEG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |