C13H16N2O2S — CID 43410411
4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]benzonitrile (PubChem CID 43410411) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]benzonitrile.
| Compound Name | 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 43410411 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]benzonitrile |
| SMILES | CN(Cc1ccc(C#N)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O2S/c1-15(13-6-7-18(16,17)10-13)9-12-4-2-11(8-14)3-5-12/h2-5,13H,6-7,9-10H2,1H3 |
| InChIKey | FQQADJWXMVJDJU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |