C15H19N3O — CID 43410832
N-(2-cyanoethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetamide (PubChem CID 43410832) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetamide |
|---|---|
| PubChem CID | 43410832 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-(2-cyanoethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetamide |
| SMILES | N#CCCNC(=O)CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H19N3O/c16-9-4-10-17-15(19)11-18-14-8-3-6-12-5-1-2-7-13(12)14/h1-2,5,7,14,18H,3-4,6,8,10-11H2,(H,17,19) |
| InChIKey | HINGSFZWBOYZMO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|