C13H17NO2 — CID 19794096
methyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate (PubChem CID 19794096) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate.
| Compound Name | methyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate |
|---|---|
| PubChem CID | 19794096 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate |
| SMILES | COC(=O)CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C13H17NO2/c1-16-13(15)9-14-12-8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7,12,14H,4,6,8-9H2,1H3 |
| InChIKey | DXGGLGASRBTSTJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |