About methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate
methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate (PubChem CID 62840360) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate.
Analyze methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate?
The IUPAC name of methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate (CID 62840360) is methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate.
What is the SMILES notation for methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate?
The canonical SMILES for methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate is COC(=O)CNC1CCCc2sccc21.
What is the InChIKey of methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate?
The InChIKey is PVQGRZXSXNYICS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-14-11(13)7-12-9-3-2-4-10-8(9)5-6-15-10/h5-6,9,12H,2-4,7H2,1H3.
What are the key properties of methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate?
methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate has a molecular weight of 225.31 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)acetate is sourced from PubChem (CID 62840360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).