C16H23NO2 — CID 60680631
butyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate (PubChem CID 60680631) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is butyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate.
| Compound Name | butyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate |
|---|---|
| PubChem CID | 60680631 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | butyl 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)acetate |
| SMILES | CCCCOC(=O)CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H23NO2/c1-2-3-11-19-16(18)12-17-15-10-6-8-13-7-4-5-9-14(13)15/h4-5,7,9,15,17H,2-3,6,8,10-12H2,1H3 |
| InChIKey | UGNBRVPWIQBGTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|