C16H15ClOS — CID 43413761
1-(3-chlorophenyl)-2-(2,5-dimethylphenyl)sulfanylethanone (PubChem CID 43413761) has the molecular formula C16H15ClOS and a molecular weight of 290.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2,5-dimethylphenyl)sulfanylethanone.
| Compound Name | 1-(3-chlorophenyl)-2-(2,5-dimethylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 43413761 |
| Molecular Formula | C16H15ClOS |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2,5-dimethylphenyl)sulfanylethanone |
| SMILES | Cc1ccc(C)c(SCC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H15ClOS/c1-11-6-7-12(2)16(8-11)19-10-15(18)13-4-3-5-14(17)9-13/h3-9H,10H2,1-2H3 |
| InChIKey | QSKHMVRERFETRA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |