C17H18ClNO — CID 63566298
1-(3-chlorophenyl)-2-(N,2,4-trimethylanilino)ethanone (PubChem CID 63566298) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(N,2,4-trimethylanilino)ethanone.
| Compound Name | 1-(3-chlorophenyl)-2-(N,2,4-trimethylanilino)ethanone |
|---|---|
| PubChem CID | 63566298 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(N,2,4-trimethylanilino)ethanone |
| SMILES | Cc1ccc(N(C)CC(=O)c2cccc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C17H18ClNO/c1-12-7-8-16(13(2)9-12)19(3)11-17(20)14-5-4-6-15(18)10-14/h4-10H,11H2,1-3H3 |
| InChIKey | PNYBSELYWCFNDE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |