C10H16F3NO3 — CID 43417461
1-(3-hydroxypiperidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 43417461) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-(3-hydroxypiperidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(3-hydroxypiperidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 43417461 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(3-hydroxypiperidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)N1CCCC(O)C1 |
| InChI | InChI=1S/C10H16F3NO3/c11-10(12,13)7-17-5-3-9(16)14-4-1-2-8(15)6-14/h8,15H,1-7H2 |
| InChIKey | JCZHKBIKKMGBOQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|