C8H17NO2S — CID 43418189
N-(2-hydroxypropyl)-2-propan-2-ylsulfanylacetamide (PubChem CID 43418189) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2-propan-2-ylsulfanylacetamide.
| Compound Name | N-(2-hydroxypropyl)-2-propan-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 43418189 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | N-(2-hydroxypropyl)-2-propan-2-ylsulfanylacetamide |
| SMILES | CC(O)CNC(=O)CSC(C)C |
| InChI | InChI=1S/C8H17NO2S/c1-6(2)12-5-8(11)9-4-7(3)10/h6-7,10H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | DCVUVVNJYKDIID-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |