C7H12N2O2S — CID 83057845
2-(cyanomethylsulfanyl)-N-[(2S)-2-hydroxypropyl]acetamide (PubChem CID 83057845) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[(2S)-2-hydroxypropyl]acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[(2S)-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 83057845 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[(2S)-2-hydroxypropyl]acetamide |
| SMILES | C[C@H](O)CNC(=O)CSCC#N |
| InChI | InChI=1S/C7H12N2O2S/c1-6(10)4-9-7(11)5-12-3-2-8/h6,10H,3-5H2,1H3,(H,9,11)/t6-/m0/s1 |
| InChIKey | PHUJVNAARRJKID-LURJTMIESA-N |
| XLogP | -0.26 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|