C12H19N3O3 — CID 43418979
1-butyl-N-(1-hydroxypropan-2-yl)-6-oxopyridazine-3-carboxamide (PubChem CID 43418979) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-butyl-N-(1-hydroxypropan-2-yl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-(1-hydroxypropan-2-yl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 43418979 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-butyl-N-(1-hydroxypropan-2-yl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NC(C)CO)ccc1=O |
| InChI | InChI=1S/C12H19N3O3/c1-3-4-7-15-11(17)6-5-10(14-15)12(18)13-9(2)8-16/h5-6,9,16H,3-4,7-8H2,1-2H3,(H,13,18) |
| InChIKey | DEKPSSVTJNNERI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |