C11H14BrNO2S — CID 43421504
(5-bromothiophen-2-yl)-[2-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 43421504) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-[2-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (5-bromothiophen-2-yl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 43421504 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | (5-bromothiophen-2-yl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)s1)N1CCCCC1CO |
| InChI | InChI=1S/C11H14BrNO2S/c12-10-5-4-9(16-10)11(15)13-6-2-1-3-8(13)7-14/h4-5,8,14H,1-3,6-7H2 |
| InChIKey | DOXOIJPMKKBBPM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |