C11H19NO2 — CID 43421563
1-[2-(hydroxymethyl)piperidin-1-yl]-3-methylbut-2-en-1-one (PubChem CID 43421563) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)piperidin-1-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[2-(hydroxymethyl)piperidin-1-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 43421563 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-[2-(hydroxymethyl)piperidin-1-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCCCC1CO |
| InChI | InChI=1S/C11H19NO2/c1-9(2)7-11(14)12-6-4-3-5-10(12)8-13/h7,10,13H,3-6,8H2,1-2H3 |
| InChIKey | YUFGTSYZHHJIIB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|