C14H18N2O4 — CID 43423513
methyl 1-(1-methyl-2-oxopyridine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 43423513) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 1-(1-methyl-2-oxopyridine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(1-methyl-2-oxopyridine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43423513 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 1-(1-methyl-2-oxopyridine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccn(C)c(=O)c2)CC1 |
| InChI | InChI=1S/C14H18N2O4/c1-15-6-3-11(9-12(15)17)13(18)16-7-4-10(5-8-16)14(19)20-2/h3,6,9-10H,4-5,7-8H2,1-2H3 |
| InChIKey | FMUXJQINYPDASI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |