C16H20FNO3 — CID 43423733
methyl 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoate (PubChem CID 43423733) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoate.
| Compound Name | methyl 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 43423733 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)/C=C/c1ccccc1F)C(=O)OC |
| InChI | InChI=1S/C16H20FNO3/c1-4-11-16(2,15(20)21-3)18-14(19)10-9-12-7-5-6-8-13(12)17/h5-10H,4,11H2,1-3H3,(H,18,19)/b10-9+ |
| InChIKey | SUKSPEVFYYVQHO-MDZDMXLPSA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|