C11H13ClN2O2 — CID 43429048
(6-chloro-3-pyridinyl)-(3-methylmorpholin-4-yl)methanone (PubChem CID 43429048) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-(3-methylmorpholin-4-yl)methanone.
| Compound Name | (6-chloro-3-pyridinyl)-(3-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 43429048 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (6-chloro-3-pyridinyl)-(3-methylmorpholin-4-yl)methanone |
| SMILES | CC1COCCN1C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-8-7-16-5-4-14(8)11(15)9-2-3-10(12)13-6-9/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | JYMHPXYUQTUFKQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|