C18H27NO4 — CID 51938117
(3,4-dipropoxyphenyl)-[(3S)-3-methylmorpholin-4-yl]methanone (PubChem CID 51938117) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (3,4-dipropoxyphenyl)-[(3S)-3-methylmorpholin-4-yl]methanone.
| Compound Name | (3,4-dipropoxyphenyl)-[(3S)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 51938117 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (3,4-dipropoxyphenyl)-[(3S)-3-methylmorpholin-4-yl]methanone |
| SMILES | CCCOc1ccc(C(=O)N2CCOC[C@@H]2C)cc1OCCC |
| InChI | InChI=1S/C18H27NO4/c1-4-9-22-16-7-6-15(12-17(16)23-10-5-2)18(20)19-8-11-21-13-14(19)3/h6-7,12,14H,4-5,8-11,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | TYLOMFFCUYAPMH-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |