C13H21NO3 — CID 43431506
methyl 2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-2-methylpentanoate (PubChem CID 43431506) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl 2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-2-methylpentanoate.
| Compound Name | methyl 2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 43431506 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl 2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-2-methylpentanoate |
| SMILES | C/C=C/C=C/C(=O)NC(C)(CCC)C(=O)OC |
| InChI | InChI=1S/C13H21NO3/c1-5-7-8-9-11(15)14-13(3,10-6-2)12(16)17-4/h5,7-9H,6,10H2,1-4H3,(H,14,15)/b7-5+,9-8+ |
| InChIKey | WUJCJVFBYWXTBA-ZIRGRKGMSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|