C14H19N3O4 — CID 43431613
ethyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate (PubChem CID 43431613) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43431613 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | ethyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cn2cccnc2=O)CC1 |
| InChI | InChI=1S/C14H19N3O4/c1-2-21-13(19)11-4-8-16(9-5-11)12(18)10-17-7-3-6-15-14(17)20/h3,6-7,11H,2,4-5,8-10H2,1H3 |
| InChIKey | FMEKGMAMUMEXCP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |