C13H17N3O4 — CID 43431614
methyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate (PubChem CID 43431614) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43431614 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl 1-[2-(2-oxopyrimidin-1-yl)acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)Cn2cccnc2=O)CC1 |
| InChI | InChI=1S/C13H17N3O4/c1-20-12(18)10-3-7-15(8-4-10)11(17)9-16-6-2-5-14-13(16)19/h2,5-6,10H,3-4,7-9H2,1H3 |
| InChIKey | HWEMGTLQIMKRBG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |