C17H28N2 — CID 43434687
2-N,2-N,3-trimethyl-1-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butane-1,2-diamine (PubChem CID 43434687) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 2-N,2-N,3-trimethyl-1-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butane-1,2-diamine.
| Compound Name | 2-N,2-N,3-trimethyl-1-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 43434687 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-N,2-N,3-trimethyl-1-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butane-1,2-diamine |
| SMILES | CC(C)C(CNC1CCc2ccccc2C1)N(C)C |
| InChI | InChI=1S/C17H28N2/c1-13(2)17(19(3)4)12-18-16-10-9-14-7-5-6-8-15(14)11-16/h5-8,13,16-18H,9-12H2,1-4H3 |
| InChIKey | AMODEFQFDFQFKG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |