C16H30F3NO — CID 43435240
N-octyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine (PubChem CID 43435240) has the molecular formula C16H30F3NO and a molecular weight of 309.42 g/mol. Its IUPAC name is N-octyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine.
| Compound Name | N-octyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43435240 |
| Molecular Formula | C16H30F3NO |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | N-octyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine |
| SMILES | CCCCCCCCNC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C16H30F3NO/c1-2-3-4-5-6-7-11-20-14-9-8-10-15(12-14)21-13-16(17,18)19/h14-15,20H,2-13H2,1H3 |
| InChIKey | GUZLYWBTFJSZMW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|