C13H22F3NO — CID 43435250
N-cyclopentyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine (PubChem CID 43435250) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is N-cyclopentyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine.
| Compound Name | N-cyclopentyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43435250 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-cyclopentyl-3-(2,2,2-trifluoroethoxy)cyclohexan-1-amine |
| SMILES | FC(F)(F)COC1CCCC(NC2CCCC2)C1 |
| InChI | InChI=1S/C13H22F3NO/c14-13(15,16)9-18-12-7-3-6-11(8-12)17-10-4-1-2-5-10/h10-12,17H,1-9H2 |
| InChIKey | AUMSFOFWNWJTCZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |