C16H19ClN2S — CID 43435775
N-[(5-chlorothiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)aniline (PubChem CID 43435775) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)aniline.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 43435775 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)aniline |
| SMILES | Clc1ccc(CNc2cccc(CN3CCCC3)c2)s1 |
| InChI | InChI=1S/C16H19ClN2S/c17-16-7-6-15(20-16)11-18-14-5-3-4-13(10-14)12-19-8-1-2-9-19/h3-7,10,18H,1-2,8-9,11-12H2 |
| InChIKey | UQMXSBIJFMYCTF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |