C14H18N2 — CID 63952076
N-prop-2-ynyl-3-(pyrrolidin-1-ylmethyl)aniline (PubChem CID 63952076) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-prop-2-ynyl-3-(pyrrolidin-1-ylmethyl)aniline.
| Compound Name | N-prop-2-ynyl-3-(pyrrolidin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 63952076 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-prop-2-ynyl-3-(pyrrolidin-1-ylmethyl)aniline |
| SMILES | C#CCNc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C14H18N2/c1-2-8-15-14-7-5-6-13(11-14)12-16-9-3-4-10-16/h1,5-7,11,15H,3-4,8-10,12H2 |
| InChIKey | NNPYEFNPSSUCNS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|