C14H16N2S — CID 43436265
2-methyl-4-N-(4-methylsulfanylphenyl)benzene-1,4-diamine (PubChem CID 43436265) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-methyl-4-N-(4-methylsulfanylphenyl)benzene-1,4-diamine.
| Compound Name | 2-methyl-4-N-(4-methylsulfanylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43436265 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-methyl-4-N-(4-methylsulfanylphenyl)benzene-1,4-diamine |
| SMILES | CSc1ccc(Nc2ccc(N)c(C)c2)cc1 |
| InChI | InChI=1S/C14H16N2S/c1-10-9-12(5-8-14(10)15)16-11-3-6-13(17-2)7-4-11/h3-9,16H,15H2,1-2H3 |
| InChIKey | WEZJLJJDTZRCKH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|