C14H27NO3 — CID 43437509
4-[butyl(ethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 43437509) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 4-[butyl(ethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 4-[butyl(ethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 43437509 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 4-[butyl(ethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CCCCN(CC)C(=O)CC(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C14H27NO3/c1-6-8-9-15(7-2)12(16)10-14(5,11(3)4)13(17)18/h11H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | XKWYIQLAMIXCCG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |