C15H23NO3S — CID 60953759
4-[ethyl(thiophen-2-ylmethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 60953759) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-[ethyl(thiophen-2-ylmethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 4-[ethyl(thiophen-2-ylmethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 60953759 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-[ethyl(thiophen-2-ylmethyl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CCN(Cc1cccs1)C(=O)CC(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C15H23NO3S/c1-5-16(10-12-7-6-8-20-12)13(17)9-15(4,11(2)3)14(18)19/h6-8,11H,5,9-10H2,1-4H3,(H,18,19) |
| InChIKey | OKVSNNPEEWTSFP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |